C23H32F4O2 — CID 121476258
2-(4-but-3-enylcyclohexyl)-5-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)oxane (PubChem CID 121476258) has the molecular formula C23H32F4O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is 2-(4-but-3-enylcyclohexyl)-5-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)oxane.
| Compound Name | 2-(4-but-3-enylcyclohexyl)-5-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)oxane |
|---|---|
| PubChem CID | 121476258 |
| Molecular Formula | C23H32F4O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2-(4-but-3-enylcyclohexyl)-5-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)oxane |
| SMILES | C=CCCC1CCC(C2CCC(C3=CC=C(OCC)C(F)(F)C3(F)F)CO2)CC1 |
| InChI | InChI=1S/C23H32F4O2/c1-3-5-6-16-7-9-17(10-8-16)20-13-11-18(15-29-20)19-12-14-21(28-4-2)23(26,27)22(19,24)25/h3,12,14,16-18,20H,1,4-11,13,15H2,2H3 |
| InChIKey | IWIRFZGAWNIKIR-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|