C32H48F6O2 — CID 121476367
5-[difluoro-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)oxymethyl]-2-[4-(4-pentylcyclohexyl)cyclohexyl]oxane (PubChem CID 121476367) has the molecular formula C32H48F6O2 and a molecular weight of 578.72 g/mol. Its IUPAC name is 5-[difluoro-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)oxymethyl]-2-[4-(4-pentylcyclohexyl)cyclohexyl]oxane.
| Compound Name | 5-[difluoro-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)oxymethyl]-2-[4-(4-pentylcyclohexyl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 121476367 |
| Molecular Formula | C32H48F6O2 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | 5-[difluoro-(5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-dien-1-yl)oxymethyl]-2-[4-(4-pentylcyclohexyl)cyclohexyl]oxane |
| SMILES | CCCCCC1CCC(C2CCC(C3CCC(C(F)(F)OC4=CC=C(CCC)C(F)(F)C4(F)F)CO3)CC2)CC1 |
| InChI | InChI=1S/C32H48F6O2/c1-3-5-6-8-22-9-11-23(12-10-22)24-13-15-25(16-14-24)28-19-17-27(21-39-28)32(37,38)40-29-20-18-26(7-4-2)30(33,34)31(29,35)36/h18,20,22-25,27-28H,3-17,19,21H2,1-2H3 |
| InChIKey | TXUWOCXQBCZUKX-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|