About 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one
4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one (PubChem CID 121476433) has the molecular formula C17H19ClF2N4O
and a molecular weight of 368.82 g/mol. Its IUPAC name is 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one |
| PubChem CID | 121476433 |
| Molecular Formula | C17H19ClF2N4O |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NC2CCCN(Cc3c(F)cccc3F)C2)c(Cl)c1=O |
| InChI | InChI=1S/C17H19ClF2N4O/c1-23-17(25)16(18)15(8-21-23)22-11-4-3-7-24(9-11)10-12-13(19)5-2-6-14(12)20/h2,5-6,8,11,22H,3-4,7,9-10H2,1H3 |
| InChIKey | JEJJCYAHCAGGCG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one?
The IUPAC name of 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one (CID 121476433) is 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one.
What is the SMILES notation for 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one?
The canonical SMILES for 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one is Cn1ncc(NC2CCCN(Cc3c(F)cccc3F)C2)c(Cl)c1=O.
What is the InChIKey of 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one?
The InChIKey is JEJJCYAHCAGGCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClF2N4O/c1-23-17(25)16(18)15(8-21-23)22-11-4-3-7-24(9-11)10-12-13(19)5-2-6-14(12)20/h2,5-6,8,11,22H,3-4,7,9-10H2,1H3.
What are the key properties of 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one?
4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one has a molecular weight of 368.82 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-[[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]amino]-2-methylpyridazin-3-one is sourced from PubChem (CID 121476433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).