C48H89N — CID 121476979
N,N-dimethyl-4-[(13Z,16Z)-4-[(Z)-octadec-9-enyl]docosa-1,13,16-trien-2-yl]cyclohexan-1-amine (PubChem CID 121476979) has the molecular formula C48H89N and a molecular weight of 680.25 g/mol. Its IUPAC name is N,N-dimethyl-4-[(13Z,16Z)-4-[(Z)-octadec-9-enyl]docosa-1,13,16-trien-2-yl]cyclohexan-1-amine.
| Compound Name | N,N-dimethyl-4-[(13Z,16Z)-4-[(Z)-octadec-9-enyl]docosa-1,13,16-trien-2-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 121476979 |
| Molecular Formula | C48H89N |
| Molecular Weight | 680.25 g/mol |
| Exact Mass | 679.70 |
| IUPAC Name | N,N-dimethyl-4-[(13Z,16Z)-4-[(Z)-octadec-9-enyl]docosa-1,13,16-trien-2-yl]cyclohexan-1-amine |
| SMILES | C=C(CC(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\CCCCCCCC)C1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C48H89N/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-46(44-45(3)47-40-42-48(43-41-47)49(4)5)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14,16,20-23,46-48H,3,6-13,15,17-19,24-44H2,1-2,4-5H3/b16-14-,22-20-,23-21- |
| InChIKey | YUZGZAGIVBHJPE-UQNIBARNSA-N |
| XLogP | 16.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.25 |
| LogP ≤ 5 | 16.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|