C25H18FN5O5 — CID 121477701
6-[(4-amino-3-oxo-1,2-dihydroquinoxalin-2-yl)methyl]-4-fluoro-8-(2-oxo-1H-pyridin-3-yl)furo[2,3-e]indole-7-carboxylic acid (PubChem CID 121477701) has the molecular formula C25H18FN5O5 and a molecular weight of 487.45 g/mol. Its IUPAC name is 6-[(4-amino-3-oxo-1,2-dihydroquinoxalin-2-yl)methyl]-4-fluoro-8-(2-oxo-1H-pyridin-3-yl)furo[2,3-e]indole-7-carboxylic acid.
| Compound Name | 6-[(4-amino-3-oxo-1,2-dihydroquinoxalin-2-yl)methyl]-4-fluoro-8-(2-oxo-1H-pyridin-3-yl)furo[2,3-e]indole-7-carboxylic acid |
|---|---|
| PubChem CID | 121477701 |
| Molecular Formula | C25H18FN5O5 |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 6-[(4-amino-3-oxo-1,2-dihydroquinoxalin-2-yl)methyl]-4-fluoro-8-(2-oxo-1H-pyridin-3-yl)furo[2,3-e]indole-7-carboxylic acid |
| SMILES | NN1C(=O)C(Cn2c(C(=O)O)c(-c3ccc[nH]c3=O)c3c4occc4c(F)cc32)Nc2ccccc21 |
| InChI | InChI=1S/C25H18FN5O5/c26-14-10-18-20(22-12(14)7-9-36-22)19(13-4-3-8-28-23(13)32)21(25(34)35)30(18)11-16-24(33)31(27)17-6-2-1-5-15(17)29-16/h1-10,16,29H,11,27H2,(H,28,32)(H,34,35) |
| InChIKey | ZOZPDZSTPHXIMR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 146.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|