C13H23FN2 — CID 121478504
N'-[(2E,4E)-4-ethyl-3-fluorohepta-2,4-dien-2-yl]-N,N-dimethylethanimidamide (PubChem CID 121478504) has the molecular formula C13H23FN2 and a molecular weight of 226.34 g/mol. Its IUPAC name is N'-[(2E,4E)-4-ethyl-3-fluorohepta-2,4-dien-2-yl]-N,N-dimethylethanimidamide.
| Compound Name | N'-[(2E,4E)-4-ethyl-3-fluorohepta-2,4-dien-2-yl]-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 121478504 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | N'-[(2E,4E)-4-ethyl-3-fluorohepta-2,4-dien-2-yl]-N,N-dimethylethanimidamide |
| SMILES | CC/C=C(CC)/C(F)=C(C)\N=C(/C)N(C)C |
| InChI | InChI=1S/C13H23FN2/c1-7-9-12(8-2)13(14)10(3)15-11(4)16(5)6/h9H,7-8H2,1-6H3/b12-9+,13-10+,15-11+ |
| InChIKey | UKDXIAUSZISPLM-KZTDSWDESA-N |
| XLogP | 3.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|