C22H32F4O2 — CID 121478627
2-[2-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)ethyl]-5-(4-methylcyclohexyl)oxane (PubChem CID 121478627) has the molecular formula C22H32F4O2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-[2-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)ethyl]-5-(4-methylcyclohexyl)oxane.
| Compound Name | 2-[2-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)ethyl]-5-(4-methylcyclohexyl)oxane |
|---|---|
| PubChem CID | 121478627 |
| Molecular Formula | C22H32F4O2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2-[2-(4-ethoxy-5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)ethyl]-5-(4-methylcyclohexyl)oxane |
| SMILES | CCOC1=CC=C(CCC2CCC(C3CCC(C)CC3)CO2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C22H32F4O2/c1-3-27-20-13-10-18(21(23,24)22(20,25)26)9-12-19-11-8-17(14-28-19)16-6-4-15(2)5-7-16/h10,13,15-17,19H,3-9,11-12,14H2,1-2H3 |
| InChIKey | UEXCUZUOACRGAU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|