About N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide
N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide (PubChem CID 121478709) has the molecular formula C15H16N4O3
and a molecular weight of 300.32 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide.
Molecular Properties
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide |
| PubChem CID | 121478709 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)Nc2cnccn2)cc1 |
| InChI | InChI=1S/C15H16N4O3/c1-22-12-4-2-11(3-5-12)6-7-18-14(20)15(21)19-13-10-16-8-9-17-13/h2-5,8-10H,6-7H2,1H3,(H,18,20)(H,17,19,21) |
| InChIKey | NJIJTTASOAVMBP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide?
The IUPAC name of N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide (CID 121478709) is N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide.
What is the SMILES notation for N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide?
The canonical SMILES for N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide is COc1ccc(CCNC(=O)C(=O)Nc2cnccn2)cc1.
What is the InChIKey of N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide?
The InChIKey is NJIJTTASOAVMBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O3/c1-22-12-4-2-11(3-5-12)6-7-18-14(20)15(21)19-13-10-16-8-9-17-13/h2-5,8-10H,6-7H2,1H3,(H,18,20)(H,17,19,21).
What are the key properties of N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide?
N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide has a molecular weight of 300.32 g/mol, XLogP of 0.78, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-methoxyphenyl)ethyl]-N'-pyrazin-2-yloxamide is sourced from PubChem (CID 121478709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).