About 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate
1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (PubChem CID 121479189) has the molecular formula C16H25NO4
and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| PubChem CID | 121479189 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| SMILES | C=CCC1=C(C(=O)OCC)CN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H25NO4/c1-6-8-12-9-10-17(15(19)21-16(3,4)5)11-13(12)14(18)20-7-2/h6H,1,7-11H2,2-5H3 |
| InChIKey | PUCAUZZQOGJBLX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (CID 121479189) is 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate is C=CCC1=C(C(=O)OCC)CN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
The InChIKey is PUCAUZZQOGJBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO4/c1-6-8-12-9-10-17(15(19)21-16(3,4)5)11-13(12)14(18)20-7-2/h6H,1,7-11H2,2-5H3.
What are the key properties of 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate has a molecular weight of 295.38 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-ethyl 4-prop-2-enyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate is sourced from PubChem (CID 121479189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).