About 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide
1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide (PubChem CID 121480088) has the molecular formula C22H18N4OS
and a molecular weight of 386.48 g/mol. Its IUPAC name is 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide |
| PubChem CID | 121480088 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide |
| SMILES | CC(C)(C#Cc1cccc(-n2nc(C(N)=O)c3ccccc32)c1)c1nccs1 |
| InChI | InChI=1S/C22H18N4OS/c1-22(2,21-24-12-13-28-21)11-10-15-6-5-7-16(14-15)26-18-9-4-3-8-17(18)19(25-26)20(23)27/h3-9,12-14H,1-2H3,(H2,23,27) |
| InChIKey | RDZTYHXUOBRBHS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide?
The IUPAC name of 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide (CID 121480088) is 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide.
What is the SMILES notation for 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide?
The canonical SMILES for 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide is CC(C)(C#Cc1cccc(-n2nc(C(N)=O)c3ccccc32)c1)c1nccs1.
What is the InChIKey of 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide?
The InChIKey is RDZTYHXUOBRBHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N4OS/c1-22(2,21-24-12-13-28-21)11-10-15-6-5-7-16(14-15)26-18-9-4-3-8-17(18)19(25-26)20(23)27/h3-9,12-14H,1-2H3,(H2,23,27).
What are the key properties of 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide?
1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide has a molecular weight of 386.48 g/mol, XLogP of 3.91, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[3-methyl-3-(1,3-thiazol-2-yl)but-1-ynyl]phenyl]indazole-3-carboxamide is sourced from PubChem (CID 121480088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).