About 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one
5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one (PubChem CID 121480202) has the molecular formula C21H24F2O2
and a molecular weight of 346.42 g/mol. Its IUPAC name is 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one.
Molecular Properties
| Compound Name | 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one |
| PubChem CID | 121480202 |
| Molecular Formula | C21H24F2O2 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one |
| SMILES | CC(=O)C(C)(CCc1ccc(-c2ccccc2)cc1)C(C)(O)C(F)F |
| InChI | InChI=1S/C21H24F2O2/c1-15(24)20(2,21(3,25)19(22)23)14-13-16-9-11-18(12-10-16)17-7-5-4-6-8-17/h4-12,19,25H,13-14H2,1-3H3 |
| InChIKey | OJNNNTYBNSLNOC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one?
The IUPAC name of 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one (CID 121480202) is 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one.
What is the SMILES notation for 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one?
The canonical SMILES for 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one is CC(=O)C(C)(CCc1ccc(-c2ccccc2)cc1)C(C)(O)C(F)F.
What is the InChIKey of 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one?
The InChIKey is OJNNNTYBNSLNOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F2O2/c1-15(24)20(2,21(3,25)19(22)23)14-13-16-9-11-18(12-10-16)17-7-5-4-6-8-17/h4-12,19,25H,13-14H2,1-3H3.
What are the key properties of 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one?
5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one has a molecular weight of 346.42 g/mol, XLogP of 4.90, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-4-hydroxy-3,4-dimethyl-3-[2-(4-phenylphenyl)ethyl]pentan-2-one is sourced from PubChem (CID 121480202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).