C11H11F11O — CID 121480379
9-ethenoxy-1,1,1,3,3,4,4,7,7,8,8-undecafluorononane (PubChem CID 121480379) has the molecular formula C11H11F11O and a molecular weight of 368.19 g/mol. Its IUPAC name is 9-ethenoxy-1,1,1,3,3,4,4,7,7,8,8-undecafluorononane.
| Compound Name | 9-ethenoxy-1,1,1,3,3,4,4,7,7,8,8-undecafluorononane |
|---|---|
| PubChem CID | 121480379 |
| Molecular Formula | C11H11F11O |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 9-ethenoxy-1,1,1,3,3,4,4,7,7,8,8-undecafluorononane |
| SMILES | C=COCC(F)(F)C(F)(F)CCC(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C11H11F11O/c1-2-23-6-10(18,19)8(14,15)4-3-7(12,13)9(16,17)5-11(20,21)22/h2H,1,3-6H2 |
| InChIKey | JGYZOZQKZDDFTJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|