About (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine
(3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine (PubChem CID 121480625) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine.
Molecular Properties
| Compound Name | (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine |
| PubChem CID | 121480625 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine |
| SMILES | [H]/N=C(/CC1C=C1C)[C@H](C)CC(C)(C)C |
| InChI | InChI=1S/C13H23N/c1-9-6-11(9)7-12(14)10(2)8-13(3,4)5/h6,10-11,14H,7-8H2,1-5H3/b14-12-/t10-,11?/m1/s1 |
| InChIKey | SAAZYWLNCWGJOC-YOGCMZGBSA-N |
| XLogP | 4.04 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine?
The IUPAC name of (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine (CID 121480625) is (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine.
What is the SMILES notation for (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine?
The canonical SMILES for (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine is [H]/N=C(/CC1C=C1C)[C@H](C)CC(C)(C)C.
What is the InChIKey of (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine?
The InChIKey is SAAZYWLNCWGJOC-YOGCMZGBSA-N. The full InChI is InChI=1S/C13H23N/c1-9-6-11(9)7-12(14)10(2)8-13(3,4)5/h6,10-11,14H,7-8H2,1-5H3/b14-12-/t10-,11?/m1/s1.
What are the key properties of (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine?
(3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine has a molecular weight of 193.33 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,5,5-trimethyl-1-(2-methylcycloprop-2-en-1-yl)hexan-2-imine is sourced from PubChem (CID 121480625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).