C28H46O5 — CID 121480827
(4R,5E,7R,8R,10R,12S,13E,15E,17E,19S)-7-hydroxy-8,19-dimethoxy-4,6,10,12,18-pentamethylhenicosa-5,13,15,17-tetraene-3,9-dione (PubChem CID 121480827) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is (4R,5E,7R,8R,10R,12S,13E,15E,17E,19S)-7-hydroxy-8,19-dimethoxy-4,6,10,12,18-pentamethylhenicosa-5,13,15,17-tetraene-3,9-dione.
| Compound Name | (4R,5E,7R,8R,10R,12S,13E,15E,17E,19S)-7-hydroxy-8,19-dimethoxy-4,6,10,12,18-pentamethylhenicosa-5,13,15,17-tetraene-3,9-dione |
|---|---|
| PubChem CID | 121480827 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | (4R,5E,7R,8R,10R,12S,13E,15E,17E,19S)-7-hydroxy-8,19-dimethoxy-4,6,10,12,18-pentamethylhenicosa-5,13,15,17-tetraene-3,9-dione |
| SMILES | CCC(=O)[C@H](C)/C=C(\C)[C@@H](O)[C@@H](OC)C(=O)[C@H](C)C[C@H](C)/C=C/C=C/C=C(\C)[C@H](CC)OC |
| InChI | InChI=1S/C28H46O5/c1-10-24(29)21(5)18-23(7)27(31)28(33-9)26(30)22(6)17-19(3)15-13-12-14-16-20(4)25(11-2)32-8/h12-16,18-19,21-22,25,27-28,31H,10-11,17H2,1-9H3/b14-12+,15-13+,20-16+,23-18+/t19-,21-,22-,25+,27-,28+/m1/s1 |
| InChIKey | XNCCXSKLMOUOCH-NDVPDSSUSA-N |
| XLogP | 5.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|