C9H19NO2S — CID 121481055
N-(3,3,4-trimethylpent-4-enyl)methanesulfonamide (PubChem CID 121481055) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is N-(3,3,4-trimethylpent-4-enyl)methanesulfonamide.
| Compound Name | N-(3,3,4-trimethylpent-4-enyl)methanesulfonamide |
|---|---|
| PubChem CID | 121481055 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-(3,3,4-trimethylpent-4-enyl)methanesulfonamide |
| SMILES | C=C(C)C(C)(C)CCNS(C)(=O)=O |
| InChI | InChI=1S/C9H19NO2S/c1-8(2)9(3,4)6-7-10-13(5,11)12/h10H,1,6-7H2,2-5H3 |
| InChIKey | HJMXJGVQQLYRFH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|