C20H24F2N2O4 — CID 121481433
(2S,3S)-4,4-difluoro-N,3-dihydroxy-2-[[4-(4-methoxyphenyl)phenyl]methylamino]-2,3-dimethylbutanamide (PubChem CID 121481433) has the molecular formula C20H24F2N2O4 and a molecular weight of 394.42 g/mol. Its IUPAC name is (2S,3S)-4,4-difluoro-N,3-dihydroxy-2-[[4-(4-methoxyphenyl)phenyl]methylamino]-2,3-dimethylbutanamide.
| Compound Name | (2S,3S)-4,4-difluoro-N,3-dihydroxy-2-[[4-(4-methoxyphenyl)phenyl]methylamino]-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 121481433 |
| Molecular Formula | C20H24F2N2O4 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (2S,3S)-4,4-difluoro-N,3-dihydroxy-2-[[4-(4-methoxyphenyl)phenyl]methylamino]-2,3-dimethylbutanamide |
| SMILES | COc1ccc(-c2ccc(CN[C@](C)(C(=O)NO)[C@](C)(O)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H24F2N2O4/c1-19(18(25)24-27,20(2,26)17(21)22)23-12-13-4-6-14(7-5-13)15-8-10-16(28-3)11-9-15/h4-11,17,23,26-27H,12H2,1-3H3,(H,24,25)/t19-,20-/m1/s1 |
| InChIKey | BWXNQIQZODKBQC-WOJBJXKFSA-N |
| XLogP | 2.73 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|