C25H25N3O8 — CID 121481738
(4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-(3-methylimidazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxylic acid (PubChem CID 121481738) has the molecular formula C25H25N3O8 and a molecular weight of 495.49 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-(3-methylimidazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxylic acid.
| Compound Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-(3-methylimidazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxylic acid |
|---|---|
| PubChem CID | 121481738 |
| Molecular Formula | C25H25N3O8 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | (4aS,5aR,12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-(3-methylimidazol-4-yl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxylic acid |
| SMILES | CN(C)c1cc(-c2cncn2C)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(=O)O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H25N3O8/c1-27(2)14-7-13(15-8-26-9-28(15)3)20(30)18-12(14)5-10-4-11-6-16(29)19(24(34)35)23(33)25(11,36)22(32)17(10)21(18)31/h7-11,30-31,33,36H,4-6H2,1-3H3,(H,34,35)/t10-,11+,25+/m1/s1 |
| InChIKey | PWAVJMUUQCVFJN-JJPWZELDSA-N |
| XLogP | 1.49 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|