C25H22ClF6N5O4 — CID 121482018
2-[[2-[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]acetyl]amino]-N-cyclopropyl-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 121482018) has the molecular formula C25H22ClF6N5O4 and a molecular weight of 605.92 g/mol. Its IUPAC name is 2-[[2-[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]acetyl]amino]-N-cyclopropyl-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[2-[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]acetyl]amino]-N-cyclopropyl-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 121482018 |
| Molecular Formula | C25H22ClF6N5O4 |
| Molecular Weight | 605.92 g/mol |
| Exact Mass | 605.13 |
| IUPAC Name | 2-[[2-[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]acetyl]amino]-N-cyclopropyl-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cn1nc(-c2ccc(Cl)cc2)n(C[C@H](O)C(F)(F)F)c1=O)NC(C(=O)NC1CC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H22ClF6N5O4/c26-16-6-4-13(5-7-16)21-35-37(23(41)36(21)11-18(38)25(30,31)32)12-19(39)34-20(22(40)33-17-8-9-17)14-2-1-3-15(10-14)24(27,28)29/h1-7,10,17-18,20,38H,8-9,11-12H2,(H,33,40)(H,34,39)/t18-,20?/m0/s1 |
| InChIKey | IOZYMARRRALLJC-LROBGIAVSA-N |
| XLogP | 3.44 |
| TPSA | 118.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.92 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |