C24H16Cl2F4N4OS — CID 121482686
6-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-1'-pyrimidin-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] (PubChem CID 121482686) has the molecular formula C24H16Cl2F4N4OS and a molecular weight of 555.38 g/mol. Its IUPAC name is 6-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-1'-pyrimidin-2-ylspiro[1H-2-benzofuran-3,3'-azetidine].
| Compound Name | 6-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-1'-pyrimidin-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] |
|---|---|
| PubChem CID | 121482686 |
| Molecular Formula | C24H16Cl2F4N4OS |
| Molecular Weight | 555.38 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | 6-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-thiazol-3-yl]-1'-pyrimidin-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] |
| SMILES | Fc1c(Cl)cc(C2(C(F)(F)F)CC(c3ccc4c(c3)COC43CN(c4ncccn4)C3)=NS2)cc1Cl |
| InChI | InChI=1S/C24H16Cl2F4N4OS/c25-17-7-15(8-18(26)20(17)27)23(24(28,29)30)9-19(33-36-23)13-2-3-16-14(6-13)10-35-22(16)11-34(12-22)21-31-4-1-5-32-21/h1-8H,9-12H2 |
| InChIKey | RXAKAMHEUUUTGK-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.38 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|