About tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate
tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 121483137) has the molecular formula C14H21F2NO4
and a molecular weight of 305.32 g/mol. Its IUPAC name is tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate |
| PubChem CID | 121483137 |
| Molecular Formula | C14H21F2NO4 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)/C(C)=C/C1CC(F)(F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21F2NO4/c1-9(11(18)20-5)6-10-7-14(15,16)8-17(10)12(19)21-13(2,3)4/h6,10H,7-8H2,1-5H3/b9-6+ |
| InChIKey | CGVVWDIBGOWIBT-RMKNXTFCSA-N |
| XLogP | 2.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate (CID 121483137) is tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate is COC(=O)/C(C)=C/C1CC(F)(F)CN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate?
The InChIKey is CGVVWDIBGOWIBT-RMKNXTFCSA-N. The full InChI is InChI=1S/C14H21F2NO4/c1-9(11(18)20-5)6-10-7-14(15,16)8-17(10)12(19)21-13(2,3)4/h6,10H,7-8H2,1-5H3/b9-6+.
What are the key properties of tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate?
tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate has a molecular weight of 305.32 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4,4-difluoro-2-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 121483137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).