C12H19N3 — CID 121484130
3-cyclohexyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine (PubChem CID 121484130) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-cyclohexyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine.
| Compound Name | 3-cyclohexyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 121484130 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3-cyclohexyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine |
| SMILES | c1nn2c(c1C1CCCCC1)CNCC2 |
| InChI | InChI=1S/C12H19N3/c1-2-4-10(5-3-1)11-8-14-15-7-6-13-9-12(11)15/h8,10,13H,1-7,9H2 |
| InChIKey | IWDFRTYTWJMRSF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |