C13H18N4O6 — CID 121484483
(6S)-3-(1-methoxy-4-nitro-1-oxobutan-2-yl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid (PubChem CID 121484483) has the molecular formula C13H18N4O6 and a molecular weight of 326.31 g/mol. Its IUPAC name is (6S)-3-(1-methoxy-4-nitro-1-oxobutan-2-yl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid.
| Compound Name | (6S)-3-(1-methoxy-4-nitro-1-oxobutan-2-yl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid |
|---|---|
| PubChem CID | 121484483 |
| Molecular Formula | C13H18N4O6 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (6S)-3-(1-methoxy-4-nitro-1-oxobutan-2-yl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylic acid |
| SMILES | COC(=O)C(CC[N+](=O)[O-])c1cnn2c1CN(C(=O)O)[C@@H](C)C2 |
| InChI | InChI=1S/C13H18N4O6/c1-8-6-16-11(7-15(8)13(19)20)10(5-14-16)9(12(18)23-2)3-4-17(21)22/h5,8-9H,3-4,6-7H2,1-2H3,(H,19,20)/t8-,9?/m0/s1 |
| InChIKey | XYWPHYKUTSINDD-IENPIDJESA-N |
| XLogP | 0.69 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|