About 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline
2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline (PubChem CID 121484655) has the molecular formula C18H13F3N4O
and a molecular weight of 358.32 g/mol. Its IUPAC name is 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline.
Molecular Properties
| Compound Name | 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline |
| PubChem CID | 121484655 |
| Molecular Formula | C18H13F3N4O |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline |
| SMILES | Cc1ncc2c(ccc3c(-c4ccc(OC(F)(F)F)cc4)n(C)nc32)n1 |
| InChI | InChI=1S/C18H13F3N4O/c1-10-22-9-14-15(23-10)8-7-13-16(14)24-25(2)17(13)11-3-5-12(6-4-11)26-18(19,20)21/h3-9H,1-2H3 |
| InChIKey | IYDUBXJNPRXFEG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline?
The IUPAC name of 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline (CID 121484655) is 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline.
What is the SMILES notation for 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline?
The canonical SMILES for 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline is Cc1ncc2c(ccc3c(-c4ccc(OC(F)(F)F)cc4)n(C)nc32)n1.
What is the InChIKey of 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline?
The InChIKey is IYDUBXJNPRXFEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N4O/c1-10-22-9-14-15(23-10)8-7-13-16(14)24-25(2)17(13)11-3-5-12(6-4-11)26-18(19,20)21/h3-9H,1-2H3.
What are the key properties of 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline?
2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline has a molecular weight of 358.32 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-f]quinazoline is sourced from PubChem (CID 121484655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).