About (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate
(5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate (PubChem CID 121484836) has the molecular formula C15H20O2
and a molecular weight of 232.32 g/mol. Its IUPAC name is (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate.
Molecular Properties
| Compound Name | (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate |
| PubChem CID | 121484836 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate |
| SMILES | CCc1ccc2c(c1)CC(C)(COC(C)=O)C2 |
| InChI | InChI=1S/C15H20O2/c1-4-12-5-6-13-8-15(3,9-14(13)7-12)10-17-11(2)16/h5-7H,4,8-10H2,1-3H3 |
| InChIKey | JRCRJWAVORPYTG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate?
The IUPAC name of (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate (CID 121484836) is (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate.
What is the SMILES notation for (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate?
The canonical SMILES for (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate is CCc1ccc2c(c1)CC(C)(COC(C)=O)C2.
What is the InChIKey of (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate?
The InChIKey is JRCRJWAVORPYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2/c1-4-12-5-6-13-8-15(3,9-14(13)7-12)10-17-11(2)16/h5-7H,4,8-10H2,1-3H3.
What are the key properties of (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate?
(5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate has a molecular weight of 232.32 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-2-methyl-1,3-dihydroinden-2-yl)methyl acetate is sourced from PubChem (CID 121484836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).