C23H30ClNO3 — CID 121485256
(1R,4aS,9E,10aR)-5-chloro-1,4a-dimethyl-7-propan-2-yl-9-prop-2-enoxyimino-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 121485256) has the molecular formula C23H30ClNO3 and a molecular weight of 403.95 g/mol. Its IUPAC name is (1R,4aS,9E,10aR)-5-chloro-1,4a-dimethyl-7-propan-2-yl-9-prop-2-enoxyimino-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,9E,10aR)-5-chloro-1,4a-dimethyl-7-propan-2-yl-9-prop-2-enoxyimino-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 121485256 |
| Molecular Formula | C23H30ClNO3 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (1R,4aS,9E,10aR)-5-chloro-1,4a-dimethyl-7-propan-2-yl-9-prop-2-enoxyimino-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | C=CCO/N=C1\C[C@H]2[C@](C)(C(=O)O)CCC[C@]2(C)c2c(Cl)cc(C(C)C)cc21 |
| InChI | InChI=1S/C23H30ClNO3/c1-6-10-28-25-18-13-19-22(4,8-7-9-23(19,5)21(26)27)20-16(18)11-15(14(2)3)12-17(20)24/h6,11-12,14,19H,1,7-10,13H2,2-5H3,(H,26,27)/b25-18+/t19-,22+,23-/m1/s1 |
| InChIKey | BEVSDHMZVSLMSD-DMJHVTLSSA-N |
| XLogP | 5.92 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|