About azane;1-methoxy-N-(1-methoxyethyl)ethanamine
azane;1-methoxy-N-(1-methoxyethyl)ethanamine (PubChem CID 121485302) has the molecular formula C6H18N2O2
and a molecular weight of 150.22 g/mol. Its IUPAC name is azane;1-methoxy-N-(1-methoxyethyl)ethanamine.
Molecular Properties
| Compound Name | azane;1-methoxy-N-(1-methoxyethyl)ethanamine |
| PubChem CID | 121485302 |
| Molecular Formula | C6H18N2O2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | azane;1-methoxy-N-(1-methoxyethyl)ethanamine |
| SMILES | COC(C)NC(C)OC.N |
| InChI | InChI=1S/C6H15NO2.H3N/c1-5(8-3)7-6(2)9-4;/h5-7H,1-4H3;1H3 |
| InChIKey | SXJZGINCROWSRA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 65.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze azane;1-methoxy-N-(1-methoxyethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-methoxy-N-(1-methoxyethyl)ethanamine?
The IUPAC name of azane;1-methoxy-N-(1-methoxyethyl)ethanamine (CID 121485302) is azane;1-methoxy-N-(1-methoxyethyl)ethanamine.
What is the SMILES notation for azane;1-methoxy-N-(1-methoxyethyl)ethanamine?
The canonical SMILES for azane;1-methoxy-N-(1-methoxyethyl)ethanamine is COC(C)NC(C)OC.N.
What is the InChIKey of azane;1-methoxy-N-(1-methoxyethyl)ethanamine?
The InChIKey is SXJZGINCROWSRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2.H3N/c1-5(8-3)7-6(2)9-4;/h5-7H,1-4H3;1H3.
What are the key properties of azane;1-methoxy-N-(1-methoxyethyl)ethanamine?
azane;1-methoxy-N-(1-methoxyethyl)ethanamine has a molecular weight of 150.22 g/mol, XLogP of 0.72, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-methoxy-N-(1-methoxyethyl)ethanamine is sourced from PubChem (CID 121485302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).