C18H16Cl2N6S — CID 121485606
6-(3,4-dichlorophenyl)-7-methyl-3-(1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 121485606) has the molecular formula C18H16Cl2N6S and a molecular weight of 419.34 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-7-methyl-3-(1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 6-(3,4-dichlorophenyl)-7-methyl-3-(1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 121485606 |
| Molecular Formula | C18H16Cl2N6S |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-7-methyl-3-(1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | CC1Sc2nnc(-c3nn(C)c4c3CCC4)n2N=C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N6S/c1-9-15(10-6-7-12(19)13(20)8-10)24-26-17(21-22-18(26)27-9)16-11-4-3-5-14(11)25(2)23-16/h6-9H,3-5H2,1-2H3 |
| InChIKey | CYAKPNQVBKIIAL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |