C48H95N9O2 — CID 121486204
4-N,4-N,6-N,6-N-tetrabutyl-2-N-[4-[methyl-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)amino]butyl]-2-N-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 121486204) has the molecular formula C48H95N9O2 and a molecular weight of 830.35 g/mol. Its IUPAC name is 4-N,4-N,6-N,6-N-tetrabutyl-2-N-[4-[methyl-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)amino]butyl]-2-N-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,4-N,6-N,6-N-tetrabutyl-2-N-[4-[methyl-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)amino]butyl]-2-N-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 121486204 |
| Molecular Formula | C48H95N9O2 |
| Molecular Weight | 830.35 g/mol |
| Exact Mass | 829.76 |
| IUPAC Name | 4-N,4-N,6-N,6-N-tetrabutyl-2-N-[4-[methyl-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)amino]butyl]-2-N-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(CCCC)c1nc(N(CCCC)CCCC)nc(N(CCCCN(C)C2CC(C)(C)N(OCCC)C(C)(C)C2)C2CC(C)(C)N(OCCC)C(C)(C)C2)n1 |
| InChI | InChI=1S/C48H95N9O2/c1-16-22-29-53(30-23-17-2)42-49-43(54(31-24-18-3)32-25-19-4)51-44(50-42)55(41-38-47(11,12)57(59-35-21-6)48(13,14)39-41)33-27-26-28-52(15)40-36-45(7,8)56(58-34-20-5)46(9,10)37-40/h40-41H,16-39H2,1-15H3 |
| InChIKey | DSPWWSUDBLZCDK-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.35 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|