About 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one
2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one (PubChem CID 121486324) has the molecular formula C6H10N6O
and a molecular weight of 182.19 g/mol. Its IUPAC name is 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one.
Molecular Properties
| Compound Name | 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one |
| PubChem CID | 121486324 |
| Molecular Formula | C6H10N6O |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one |
| SMILES | CN1C(N)=NC2C(=O)NC(N)=NC21 |
| InChI | InChI=1S/C6H10N6O/c1-12-3-2(9-6(12)8)4(13)11-5(7)10-3/h2-3H,1H3,(H2,8,9)(H3,7,10,11,13) |
| InChIKey | XRRRLKXLOOZJRE-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one?
The IUPAC name of 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one (CID 121486324) is 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one.
What is the SMILES notation for 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one?
The canonical SMILES for 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one is CN1C(N)=NC2C(=O)NC(N)=NC21.
What is the InChIKey of 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one?
The InChIKey is XRRRLKXLOOZJRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N6O/c1-12-3-2(9-6(12)8)4(13)11-5(7)10-3/h2-3H,1H3,(H2,8,9)(H3,7,10,11,13).
What are the key properties of 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one?
2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one has a molecular weight of 182.19 g/mol, XLogP of -2.61, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-diamino-9-methyl-4,5-dihydro-1H-purin-6-one is sourced from PubChem (CID 121486324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).