C28H44N2S — CID 121486555
N-[3-[(2Z,7Z)-5-ethyl-9-[(Z)-2-(methylamino)ethenyl]sulfanyldeca-2,7,9-trien-5-yl]-5-methylcyclohexyl]cyclohexa-1,5-dien-1-amine (PubChem CID 121486555) has the molecular formula C28H44N2S and a molecular weight of 440.74 g/mol. Its IUPAC name is N-[3-[(2Z,7Z)-5-ethyl-9-[(Z)-2-(methylamino)ethenyl]sulfanyldeca-2,7,9-trien-5-yl]-5-methylcyclohexyl]cyclohexa-1,5-dien-1-amine.
| Compound Name | N-[3-[(2Z,7Z)-5-ethyl-9-[(Z)-2-(methylamino)ethenyl]sulfanyldeca-2,7,9-trien-5-yl]-5-methylcyclohexyl]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 121486555 |
| Molecular Formula | C28H44N2S |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.32 |
| IUPAC Name | N-[3-[(2Z,7Z)-5-ethyl-9-[(Z)-2-(methylamino)ethenyl]sulfanyldeca-2,7,9-trien-5-yl]-5-methylcyclohexyl]cyclohexa-1,5-dien-1-amine |
| SMILES | C=C(/C=C\CC(CC)(C/C=C\C)C1CC(C)CC(NC2=CCCC=C2)C1)S/C=C\NC |
| InChI | InChI=1S/C28H44N2S/c1-6-8-16-28(7-2,17-12-13-24(4)31-19-18-29-5)25-20-23(3)21-27(22-25)30-26-14-10-9-11-15-26/h6,8,10,12-15,18-19,23,25,27,29-30H,4,7,9,11,16-17,20-22H2,1-3,5H3/b8-6-,13-12-,19-18- |
| InChIKey | LFVLSMODJUEMDH-KNBKZBFGSA-N |
| XLogP | 7.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|