C18H27N5O6 — CID 121486762
(2R,3R,4R,5R)-2-[6-[(2,2-dimethyl-1,3-dioxan-4-yl)methylamino]purin-9-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (PubChem CID 121486762) has the molecular formula C18H27N5O6 and a molecular weight of 409.44 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[6-[(2,2-dimethyl-1,3-dioxan-4-yl)methylamino]purin-9-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-[6-[(2,2-dimethyl-1,3-dioxan-4-yl)methylamino]purin-9-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 121486762 |
| Molecular Formula | C18H27N5O6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (2R,3R,4R,5R)-2-[6-[(2,2-dimethyl-1,3-dioxan-4-yl)methylamino]purin-9-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| SMILES | CC1(C)OCCC(CNc2ncnc3c2ncn3[C@@H]2O[C@H](CO)[C@@H](O)[C@@]2(C)O)O1 |
| InChI | InChI=1S/C18H27N5O6/c1-17(2)27-5-4-10(29-17)6-19-14-12-15(21-8-20-14)23(9-22-12)16-18(3,26)13(25)11(7-24)28-16/h8-11,13,16,24-26H,4-7H2,1-3H3,(H,19,20,21)/t10?,11-,13-,16-,18-/m1/s1 |
| InChIKey | PNNCDIBXHGZFMY-HGRYKIGZSA-N |
| XLogP | -0.22 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |