C15H23FN2O6 — CID 121487117
1-[(3aR,4R,6S,6aS)-6-[(R)-fluoro(methoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-methyl-1-[(Z)-2-methyl-3-oxoprop-1-enyl]urea (PubChem CID 121487117) has the molecular formula C15H23FN2O6 and a molecular weight of 346.36 g/mol. Its IUPAC name is 1-[(3aR,4R,6S,6aS)-6-[(R)-fluoro(methoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-methyl-1-[(Z)-2-methyl-3-oxoprop-1-enyl]urea.
| Compound Name | 1-[(3aR,4R,6S,6aS)-6-[(R)-fluoro(methoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-methyl-1-[(Z)-2-methyl-3-oxoprop-1-enyl]urea |
|---|---|
| PubChem CID | 121487117 |
| Molecular Formula | C15H23FN2O6 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[(3aR,4R,6S,6aS)-6-[(R)-fluoro(methoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-methyl-1-[(Z)-2-methyl-3-oxoprop-1-enyl]urea |
| SMILES | CNC(=O)N(/C=C(/C)C=O)[C@@H]1O[C@H]([C@@H](F)OC)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C15H23FN2O6/c1-8(7-19)6-18(14(20)17-4)13-11-9(23-15(2,3)24-11)10(22-13)12(16)21-5/h6-7,9-13H,1-5H3,(H,17,20)/b8-6-/t9-,10+,11-,12+,13-/m1/s1 |
| InChIKey | IVLLJPCETGWLBJ-BKOSKZPISA-N |
| XLogP | 0.92 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|