C12H20N2O6 — CID 121487165
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]-3-methyl-1-[(Z)-2-methyl-3-oxoprop-1-enyl]urea (PubChem CID 121487165) has the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]-3-methyl-1-[(Z)-2-methyl-3-oxoprop-1-enyl]urea.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]-3-methyl-1-[(Z)-2-methyl-3-oxoprop-1-enyl]urea |
|---|---|
| PubChem CID | 121487165 |
| Molecular Formula | C12H20N2O6 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]-3-methyl-1-[(Z)-2-methyl-3-oxoprop-1-enyl]urea |
| SMILES | CNC(=O)N(/C=C(/C)C=O)[C@@H]1O[C@](C)(CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H20N2O6/c1-7(5-15)4-14(11(19)13-3)10-8(17)9(18)12(2,6-16)20-10/h4-5,8-10,16-18H,6H2,1-3H3,(H,13,19)/b7-4-/t8-,9+,10-,12-/m1/s1 |
| InChIKey | YLBRMBVTZMNKCW-FNKYPJRESA-N |
| XLogP | -1.44 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|