C25H26Cl2N4O5 — CID 121487206
1-[(Z)-2-[1,3-bis(3-chlorophenyl)-2H-imidazol-2-yl]-3-oxoprop-1-enyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylurea (PubChem CID 121487206) has the molecular formula C25H26Cl2N4O5 and a molecular weight of 533.41 g/mol. Its IUPAC name is 1-[(Z)-2-[1,3-bis(3-chlorophenyl)-2H-imidazol-2-yl]-3-oxoprop-1-enyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylurea.
| Compound Name | 1-[(Z)-2-[1,3-bis(3-chlorophenyl)-2H-imidazol-2-yl]-3-oxoprop-1-enyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 121487206 |
| Molecular Formula | C25H26Cl2N4O5 |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 1-[(Z)-2-[1,3-bis(3-chlorophenyl)-2H-imidazol-2-yl]-3-oxoprop-1-enyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylurea |
| SMILES | CNC(=O)N(/C=C(\C=O)C1N(c2cccc(Cl)c2)C=CN1c1cccc(Cl)c1)[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C25H26Cl2N4O5/c1-28-25(35)31(23-12-21(34)22(15-33)36-23)13-16(14-32)24-29(19-6-2-4-17(26)10-19)8-9-30(24)20-7-3-5-18(27)11-20/h2-11,13-14,21-24,33-34H,12,15H2,1H3,(H,28,35)/b16-13+/t21-,22+,23+/m0/s1 |
| InChIKey | XTIGZEQOPXSLAR-PXXWLEBKSA-N |
| XLogP | 3.31 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|