About (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one
(E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one (PubChem CID 121490004) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one.
Molecular Properties
| Compound Name | (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one |
| PubChem CID | 121490004 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one |
| SMILES | C#CC#C/C=C/[C@H](O)CCCCCC(C)=O |
| InChI | InChI=1S/C14H18O2/c1-3-4-5-8-11-14(16)12-9-6-7-10-13(2)15/h1,8,11,14,16H,6-7,9-10,12H2,2H3/b11-8+/t14-/m0/s1 |
| InChIKey | VOJIMVBNCSNSBJ-ZHZWZMEUSA-N |
| XLogP | 2.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one?
The IUPAC name of (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one (CID 121490004) is (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one.
What is the SMILES notation for (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one?
The canonical SMILES for (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one is C#CC#C/C=C/[C@H](O)CCCCCC(C)=O.
What is the InChIKey of (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one?
The InChIKey is VOJIMVBNCSNSBJ-ZHZWZMEUSA-N. The full InChI is InChI=1S/C14H18O2/c1-3-4-5-8-11-14(16)12-9-6-7-10-13(2)15/h1,8,11,14,16H,6-7,9-10,12H2,2H3/b11-8+/t14-/m0/s1.
What are the key properties of (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one?
(E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one has a molecular weight of 218.30 g/mol, XLogP of 2.08, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,8R)-8-hydroxytetradec-9-en-11,13-diyn-2-one is sourced from PubChem (CID 121490004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).