C14H16Cl2N4 — CID 1214927
5-[3-(3,4-dichlorophenyl)propyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 1214927) has the molecular formula C14H16Cl2N4 and a molecular weight of 311.22 g/mol. Its IUPAC name is 5-[3-(3,4-dichlorophenyl)propyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 5-[3-(3,4-dichlorophenyl)propyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 1214927 |
| Molecular Formula | C14H16Cl2N4 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 5-[3-(3,4-dichlorophenyl)propyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1nc(N)nc(N)c1CCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N4/c1-8-10(13(17)20-14(18)19-8)4-2-3-9-5-6-11(15)12(16)7-9/h5-7H,2-4H2,1H3,(H4,17,18,19,20) |
| InChIKey | POECRTSPCBGKQA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |