About (2S)-2,4-dimethylpentanenitrile
(2S)-2,4-dimethylpentanenitrile (PubChem CID 121493485) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is (2S)-2,4-dimethylpentanenitrile.
Molecular Properties
| Compound Name | (2S)-2,4-dimethylpentanenitrile |
| PubChem CID | 121493485 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | (2S)-2,4-dimethylpentanenitrile |
| SMILES | CC(C)CC(C)C#N |
| InChI | InChI=1S/C7H13N/c1-6(2)4-7(3)5-8/h6-7H,4H2,1-3H3 |
| InChIKey | COXCGWKSEPPDAA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2,4-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,4-dimethylpentanenitrile?
The IUPAC name of (2S)-2,4-dimethylpentanenitrile (CID 121493485) is (2S)-2,4-dimethylpentanenitrile.
What is the SMILES notation for (2S)-2,4-dimethylpentanenitrile?
The canonical SMILES for (2S)-2,4-dimethylpentanenitrile is CC(C)CC(C)C#N.
What is the InChIKey of (2S)-2,4-dimethylpentanenitrile?
The InChIKey is COXCGWKSEPPDAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N/c1-6(2)4-7(3)5-8/h6-7H,4H2,1-3H3.
What are the key properties of (2S)-2,4-dimethylpentanenitrile?
(2S)-2,4-dimethylpentanenitrile has a molecular weight of 111.19 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,4-dimethylpentanenitrile is sourced from PubChem (CID 121493485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).