C23H19NO2 — CID 121493676
3-[(Z)-1,2-bis(2-methoxyphenyl)ethenyl]benzonitrile (PubChem CID 121493676) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-[(Z)-1,2-bis(2-methoxyphenyl)ethenyl]benzonitrile.
| Compound Name | 3-[(Z)-1,2-bis(2-methoxyphenyl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 121493676 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-[(Z)-1,2-bis(2-methoxyphenyl)ethenyl]benzonitrile |
| SMILES | COc1ccccc1/C=C(/c1cccc(C#N)c1)c1ccccc1OC |
| InChI | InChI=1S/C23H19NO2/c1-25-22-12-5-3-9-19(22)15-21(18-10-7-8-17(14-18)16-24)20-11-4-6-13-23(20)26-2/h3-15H,1-2H3/b21-15- |
| InChIKey | ALGBBPLKGSMOJT-QNGOZBTKSA-N |
| XLogP | 5.16 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|