About (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine
(2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine (PubChem CID 121493763) has the molecular formula C19H21F2N3O
and a molecular weight of 345.39 g/mol. Its IUPAC name is (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine.
Molecular Properties
| Compound Name | (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine |
| PubChem CID | 121493763 |
| Molecular Formula | C19H21F2N3O |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine |
| SMILES | Fc1ccc(C2CC(c3ccc([C@@H]4CNCCO4)cc3)NN2)c(F)c1 |
| InChI | InChI=1S/C19H21F2N3O/c20-14-5-6-15(16(21)9-14)18-10-17(23-24-18)12-1-3-13(4-2-12)19-11-22-7-8-25-19/h1-6,9,17-19,22-24H,7-8,10-11H2/t17?,18?,19-/m0/s1 |
| InChIKey | ZKKBAESRODUKLX-ACBHZAAOSA-N |
| XLogP | 2.91 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine?
The IUPAC name of (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine (CID 121493763) is (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine.
What is the SMILES notation for (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine?
The canonical SMILES for (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine is Fc1ccc(C2CC(c3ccc([C@@H]4CNCCO4)cc3)NN2)c(F)c1.
What is the InChIKey of (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine?
The InChIKey is ZKKBAESRODUKLX-ACBHZAAOSA-N. The full InChI is InChI=1S/C19H21F2N3O/c20-14-5-6-15(16(21)9-14)18-10-17(23-24-18)12-1-3-13(4-2-12)19-11-22-7-8-25-19/h1-6,9,17-19,22-24H,7-8,10-11H2/t17?,18?,19-/m0/s1.
What are the key properties of (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine?
(2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine has a molecular weight of 345.39 g/mol, XLogP of 2.91, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[4-[5-(2,4-difluorophenyl)pyrazolidin-3-yl]phenyl]morpholine is sourced from PubChem (CID 121493763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).