C31H31NO5 — CID 121493797
N-[3-hydroxy-2-[2-(3-methoxy-4-phenylmethoxyphenyl)ethyl]-4-phenylmethoxyphenyl]acetamide (PubChem CID 121493797) has the molecular formula C31H31NO5 and a molecular weight of 497.59 g/mol. Its IUPAC name is N-[3-hydroxy-2-[2-(3-methoxy-4-phenylmethoxyphenyl)ethyl]-4-phenylmethoxyphenyl]acetamide.
| Compound Name | N-[3-hydroxy-2-[2-(3-methoxy-4-phenylmethoxyphenyl)ethyl]-4-phenylmethoxyphenyl]acetamide |
|---|---|
| PubChem CID | 121493797 |
| Molecular Formula | C31H31NO5 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | N-[3-hydroxy-2-[2-(3-methoxy-4-phenylmethoxyphenyl)ethyl]-4-phenylmethoxyphenyl]acetamide |
| SMILES | COc1cc(CCc2c(NC(C)=O)ccc(OCc3ccccc3)c2O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H31NO5/c1-22(33)32-27-16-18-29(37-21-25-11-7-4-8-12-25)31(34)26(27)15-13-23-14-17-28(30(19-23)35-2)36-20-24-9-5-3-6-10-24/h3-12,14,16-19,34H,13,15,20-21H2,1-2H3,(H,32,33) |
| InChIKey | LOLRDPRRVJYDPZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |