C21H29BN3O6- — CID 121493997
trihydroxy-[(1R)-1-[[(2S,3S)-3-hydroxy-2-[(6-phenylpyridine-2-carbonyl)amino]butanoyl]amino]-3-methylbutyl]boranuide (PubChem CID 121493997) has the molecular formula C21H29BN3O6- and a molecular weight of 430.29 g/mol. Its IUPAC name is trihydroxy-[(1R)-1-[[(2S,3S)-3-hydroxy-2-[(6-phenylpyridine-2-carbonyl)amino]butanoyl]amino]-3-methylbutyl]boranuide.
| Compound Name | trihydroxy-[(1R)-1-[[(2S,3S)-3-hydroxy-2-[(6-phenylpyridine-2-carbonyl)amino]butanoyl]amino]-3-methylbutyl]boranuide |
|---|---|
| PubChem CID | 121493997 |
| Molecular Formula | C21H29BN3O6- |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | trihydroxy-[(1R)-1-[[(2S,3S)-3-hydroxy-2-[(6-phenylpyridine-2-carbonyl)amino]butanoyl]amino]-3-methylbutyl]boranuide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1cccc(-c2ccccc2)n1)[C@H](C)O)[B-](O)(O)O |
| InChI | InChI=1S/C21H29BN3O6/c1-13(2)12-18(22(29,30)31)24-21(28)19(14(3)26)25-20(27)17-11-7-10-16(23-17)15-8-5-4-6-9-15/h4-11,13-14,18-19,26,29-31H,12H2,1-3H3,(H,24,28)(H,25,27)/q-1/t14-,18-,19-/m0/s1 |
| InChIKey | UEAQGIFJGDDSNH-JVPBZIDWSA-N |
| XLogP | 0.21 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|