About didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate
didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate (PubChem CID 121494068) has the molecular formula C28H50O5
and a molecular weight of 466.70 g/mol. Its IUPAC name is didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate.
Molecular Properties
| Compound Name | didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate |
| PubChem CID | 121494068 |
| Molecular Formula | C28H50O5 |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.37 |
| IUPAC Name | didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate |
| SMILES | CCCCCCCCCCOC(=O)C1C[C@@H]2O[C@@H]2CC1C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C28H50O5/c1-3-5-7-9-11-13-15-17-19-31-27(29)23-21-25-26(33-25)22-24(23)28(30)32-20-18-16-14-12-10-8-6-4-2/h23-26H,3-22H2,1-2H3/t23?,24?,25-,26+ |
| InChIKey | DVLBHXHZAWSIBU-TXFWVUOCSA-N |
| XLogP | 7.15 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate?
The IUPAC name of didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate (CID 121494068) is didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate.
What is the SMILES notation for didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate?
The canonical SMILES for didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate is CCCCCCCCCCOC(=O)C1C[C@@H]2O[C@@H]2CC1C(=O)OCCCCCCCCCC.
What is the InChIKey of didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate?
The InChIKey is DVLBHXHZAWSIBU-TXFWVUOCSA-N. The full InChI is InChI=1S/C28H50O5/c1-3-5-7-9-11-13-15-17-19-31-27(29)23-21-25-26(33-25)22-24(23)28(30)32-20-18-16-14-12-10-8-6-4-2/h23-26H,3-22H2,1-2H3/t23?,24?,25-,26+.
What are the key properties of didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate?
didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate has a molecular weight of 466.70 g/mol, XLogP of 7.15, 20 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl (1R,6S)-7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate is sourced from PubChem (CID 121494068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).