About (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione
(4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione (PubChem CID 121494084) has the molecular formula C15H22O4
and a molecular weight of 266.34 g/mol. Its IUPAC name is (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione.
Molecular Properties
| Compound Name | (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione |
| PubChem CID | 121494084 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione |
| SMILES | CC(C)C(O)C(=O)C[C@@H](C)CCC(=O)c1ccoc1 |
| InChI | InChI=1S/C15H22O4/c1-10(2)15(18)14(17)8-11(3)4-5-13(16)12-6-7-19-9-12/h6-7,9-11,15,18H,4-5,8H2,1-3H3/t11-,15?/m0/s1 |
| InChIKey | HCPDJZNVPUCXHZ-VPHXOMNUSA-N |
| XLogP | 2.85 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione?
The IUPAC name of (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione (CID 121494084) is (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione.
What is the SMILES notation for (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione?
The canonical SMILES for (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione is CC(C)C(O)C(=O)C[C@@H](C)CCC(=O)c1ccoc1.
What is the InChIKey of (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione?
The InChIKey is HCPDJZNVPUCXHZ-VPHXOMNUSA-N. The full InChI is InChI=1S/C15H22O4/c1-10(2)15(18)14(17)8-11(3)4-5-13(16)12-6-7-19-9-12/h6-7,9-11,15,18H,4-5,8H2,1-3H3/t11-,15?/m0/s1.
What are the key properties of (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione?
(4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione has a molecular weight of 266.34 g/mol, XLogP of 2.85, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-(furan-3-yl)-7-hydroxy-4,8-dimethylnonane-1,6-dione is sourced from PubChem (CID 121494084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).