About N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine
N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine (PubChem CID 121494093) has the molecular formula C24H29N
and a molecular weight of 331.50 g/mol. Its IUPAC name is N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine.
Molecular Properties
| Compound Name | N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine |
| PubChem CID | 121494093 |
| Molecular Formula | C24H29N |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine |
| SMILES | CC(C)(C)CC(C)(C)c1ccc2ccc(Nc3ccccc3)cc2c1 |
| InChI | InChI=1S/C24H29N/c1-23(2,3)17-24(4,5)20-13-11-18-12-14-22(16-19(18)15-20)25-21-9-7-6-8-10-21/h6-16,25H,17H2,1-5H3 |
| InChIKey | WMLKTLDRCSEWQL-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine?
The IUPAC name of N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine (CID 121494093) is N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine.
What is the SMILES notation for N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine?
The canonical SMILES for N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine is CC(C)(C)CC(C)(C)c1ccc2ccc(Nc3ccccc3)cc2c1.
What is the InChIKey of N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine?
The InChIKey is WMLKTLDRCSEWQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N/c1-23(2,3)17-24(4,5)20-13-11-18-12-14-22(16-19(18)15-20)25-21-9-7-6-8-10-21/h6-16,25H,17H2,1-5H3.
What are the key properties of N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine?
N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine has a molecular weight of 331.50 g/mol, XLogP of 7.30, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-7-(2,4,4-trimethylpentan-2-yl)naphthalen-2-amine is sourced from PubChem (CID 121494093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).