About (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile
(1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile (PubChem CID 121494105) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile.
Molecular Properties
| Compound Name | (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile |
| PubChem CID | 121494105 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile |
| SMILES | CC1C(C#N)[C@]2(C)CC[C@H]1C2 |
| InChI | InChI=1S/C10H15N/c1-7-8-3-4-10(2,5-8)9(7)6-11/h7-9H,3-5H2,1-2H3/t7?,8-,9?,10+/m0/s1 |
| InChIKey | BDYGNAKOXIGYCJ-RVXWLBMTSA-N |
| XLogP | 2.58 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile?
The IUPAC name of (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile (CID 121494105) is (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile.
What is the SMILES notation for (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile?
The canonical SMILES for (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile is CC1C(C#N)[C@]2(C)CC[C@H]1C2.
What is the InChIKey of (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile?
The InChIKey is BDYGNAKOXIGYCJ-RVXWLBMTSA-N. The full InChI is InChI=1S/C10H15N/c1-7-8-3-4-10(2,5-8)9(7)6-11/h7-9H,3-5H2,1-2H3/t7?,8-,9?,10+/m0/s1.
What are the key properties of (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile?
(1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile has a molecular weight of 149.24 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4S)-1,3-dimethylbicyclo[2.2.1]heptane-2-carbonitrile is sourced from PubChem (CID 121494105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).