C12H8F5NO2 — CID 121494134
1-(2,2,3,3,3-pentafluoropropyl)indole-4-carboxylic acid (PubChem CID 121494134) has the molecular formula C12H8F5NO2 and a molecular weight of 293.19 g/mol. Its IUPAC name is 1-(2,2,3,3,3-pentafluoropropyl)indole-4-carboxylic acid.
| Compound Name | 1-(2,2,3,3,3-pentafluoropropyl)indole-4-carboxylic acid |
|---|---|
| PubChem CID | 121494134 |
| Molecular Formula | C12H8F5NO2 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 1-(2,2,3,3,3-pentafluoropropyl)indole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1ccn2CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F5NO2/c13-11(14,12(15,16)17)6-18-5-4-7-8(10(19)20)2-1-3-9(7)18/h1-5H,6H2,(H,19,20) |
| InChIKey | QLJZMHDXLVZMLN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|