C22H23FN2O2 — CID 121494998
3-(3-cyano-4-fluorophenyl)-N-cyclohexyl-N-(2-hydroxyethyl)benzamide (PubChem CID 121494998) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is 3-(3-cyano-4-fluorophenyl)-N-cyclohexyl-N-(2-hydroxyethyl)benzamide.
| Compound Name | 3-(3-cyano-4-fluorophenyl)-N-cyclohexyl-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 121494998 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 3-(3-cyano-4-fluorophenyl)-N-cyclohexyl-N-(2-hydroxyethyl)benzamide |
| SMILES | N#Cc1cc(-c2cccc(C(=O)N(CCO)C3CCCCC3)c2)ccc1F |
| InChI | InChI=1S/C22H23FN2O2/c23-21-10-9-17(14-19(21)15-24)16-5-4-6-18(13-16)22(27)25(11-12-26)20-7-2-1-3-8-20/h4-6,9-10,13-14,20,26H,1-3,7-8,11-12H2 |
| InChIKey | KCDANCUZBCLNPN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |