About cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone
cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone (PubChem CID 121495421) has the molecular formula C17H29N3O
and a molecular weight of 291.44 g/mol. Its IUPAC name is cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone |
| PubChem CID | 121495421 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CCC1)N1CCC(N2C[C@H]3CC[C@@H](C2)NC3)CC1 |
| InChI | InChI=1S/C17H29N3O/c21-17(14-2-1-3-14)19-8-6-16(7-9-19)20-11-13-4-5-15(12-20)18-10-13/h13-16,18H,1-12H2/t13-,15-/m0/s1 |
| InChIKey | VENBSDFUAYVXTR-ZFWWWQNUSA-N |
| XLogP | 1.46 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone?
The IUPAC name of cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone (CID 121495421) is cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone.
What is the SMILES notation for cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone?
The canonical SMILES for cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone is O=C(C1CCC1)N1CCC(N2C[C@H]3CC[C@@H](C2)NC3)CC1.
What is the InChIKey of cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone?
The InChIKey is VENBSDFUAYVXTR-ZFWWWQNUSA-N. The full InChI is InChI=1S/C17H29N3O/c21-17(14-2-1-3-14)19-8-6-16(7-9-19)20-11-13-4-5-15(12-20)18-10-13/h13-16,18H,1-12H2/t13-,15-/m0/s1.
What are the key properties of cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone?
cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone has a molecular weight of 291.44 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl-[4-[(1S,5S)-3,6-diazabicyclo[3.2.2]nonan-3-yl]piperidin-1-yl]methanone is sourced from PubChem (CID 121495421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).