C21H27N5O2 — CID 121495614
N-[(3S)-1-benzylpyrrolidin-3-yl]-4-(1H-pyrrole-2-carbonyl)piperazine-1-carboxamide (PubChem CID 121495614) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[(3S)-1-benzylpyrrolidin-3-yl]-4-(1H-pyrrole-2-carbonyl)piperazine-1-carboxamide.
| Compound Name | N-[(3S)-1-benzylpyrrolidin-3-yl]-4-(1H-pyrrole-2-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 121495614 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[(3S)-1-benzylpyrrolidin-3-yl]-4-(1H-pyrrole-2-carbonyl)piperazine-1-carboxamide |
| SMILES | O=C(N[C@H]1CCN(Cc2ccccc2)C1)N1CCN(C(=O)c2ccc[nH]2)CC1 |
| InChI | InChI=1S/C21H27N5O2/c27-20(19-7-4-9-22-19)25-11-13-26(14-12-25)21(28)23-18-8-10-24(16-18)15-17-5-2-1-3-6-17/h1-7,9,18,22H,8,10-16H2,(H,23,28)/t18-/m0/s1 |
| InChIKey | YGIDHBHEKUCFND-SFHVURJKSA-N |
| XLogP | 1.76 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |