C21H22N4O2 — CID 121497364
1-[4-(1-methylindazol-5-yl)benzoyl]piperidine-4-carboxamide (PubChem CID 121497364) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-[4-(1-methylindazol-5-yl)benzoyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(1-methylindazol-5-yl)benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121497364 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-[4-(1-methylindazol-5-yl)benzoyl]piperidine-4-carboxamide |
| SMILES | Cn1ncc2cc(-c3ccc(C(=O)N4CCC(C(N)=O)CC4)cc3)ccc21 |
| InChI | InChI=1S/C21H22N4O2/c1-24-19-7-6-17(12-18(19)13-23-24)14-2-4-16(5-3-14)21(27)25-10-8-15(9-11-25)20(22)26/h2-7,12-13,15H,8-11H2,1H3,(H2,22,26) |
| InChIKey | IHVJYVXSEAZJRK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |